ChemNet > CAS > 148583-59-9 1-(2,6-Dimethoxyphenyl)piperazine
148583-59-9 1-(2,6-Dimethoxyphenyl)piperazine
상품명칭 |
1-(2,6-Dimethoxyphenyl)piperazine |
분자식 |
C12H18N2O2 |
분자량 |
222.2835 |
InChI |
InChI=1/C12H18N2O2/c1-15-10-4-3-5-11(16-2)12(10)14-8-6-13-7-9-14/h3-5,13H,6-9H2,1-2H3 |
cas번호 |
148583-59-9 |
분자 구조 |
|
밀도 |
1.08g/cm3 |
비등점 |
375.4°C at 760 mmHg |
굴절 지수 |
1.526 |
인화점 |
180.8°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|