ChemNet > CAS > 1497-19-4 Alpha-Methyl-Alpha-propylsuccinimide
1497-19-4 Alpha-Methyl-Alpha-propylsuccinimide
| 상품명칭 |
Alpha-Methyl-Alpha-propylsuccinimide |
| 별명 |
Methylpropylsuccinimide; 2,5-Pyrrolidinedione, 3-methyl-3-propyl-; 3-Methyl-3-propylpyrrolidine-2,5-dione; (3S)-3-methyl-3-propylpyrrolidine-2,5-dione; (3R)-3-methyl-3-propylpyrrolidine-2,5-dione |
| 분자식 |
C8H13NO2 |
| 분자량 |
155.1943 |
| InChI |
InChI=1/C8H13NO2/c1-3-4-8(2)5-6(10)9-7(8)11/h3-5H2,1-2H3,(H,9,10,11)/t8-/m1/s1 |
| cas번호 |
1497-19-4 |
| EC번호 |
216-092-2 |
| 분자 구조 |
|
| 밀도 |
1.032g/cm3 |
| 녹는 점 |
76-78℃ |
| 비등점 |
279.2°C at 760 mmHg |
| 굴절 지수 |
1.453 |
| 인화점 |
124.2°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|
