ChemNet > CAS > 150-77-6 N,N,N',N'-Tetraethylethylenediamine
150-77-6 N,N,N',N'-Tetraethylethylenediamine
상품명칭 |
N,N,N',N'-Tetraethylethylenediamine |
별명 |
1,2-Bis(diethylamino)ethane; N,N,N',N'-tetraethylethane-1,2-diamine; N,N,N',N'-tetraethylethane-1,2-diaminium |
분자식 |
C10H26N2 |
분자량 |
174.3257 |
InChI |
InChI=1/C10H24N2/c1-5-11(6-2)9-10-12(7-3)8-4/h5-10H2,1-4H3/p+2 |
cas번호 |
150-77-6 |
EC번호 |
205-770-3 |
분자 구조 |
|
비등점 |
190.5°C at 760 mmHg |
인화점 |
58.9°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R22:Harmful if swallowed.;
R34:Causes burns.;
|
보안 규칙 |
S25:Avoid contact with eyes.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|