ChemNet > CAS > 15217-53-5 1-ethyl-1H-1,2,3,4-tetraazole-5-thiol
15217-53-5 1-ethyl-1H-1,2,3,4-tetraazole-5-thiol
| 상품명칭 |
1-ethyl-1H-1,2,3,4-tetraazole-5-thiol |
| 별명 |
1-Ethyl-5-mercaptotetrazole; 1-ETHYL-5-MERCAPTO-1H-TETRAZOLE; 1-ETHYL-1H-TETRAZOLE-5-THIOL; 1-ethyl-1,2-dihydro-5h-tetrazole-5-thione; 1-ETHYL-1H-1,2,3,4-TETRAZOLE-5-THIOL; 1-Ethyl-5-mercapto-1,2,3,4-tetrazole; 1-ETHYL-1,4-DIHYDRO-TETRAZOLE-5-THIONE |
| 분자식 |
C3H6N4S |
| 분자량 |
130.1715 |
| InChI |
InChI=1/C3H6N4S/c1-2-7-3(8)4-5-6-7/h2H2,1H3,(H,4,6,8) |
| cas번호 |
15217-53-5 |
| EC번호 |
239-270-1 |
| 분자 구조 |
|
| 밀도 |
1.53g/cm3 |
| 비등점 |
136.4°C at 760 mmHg |
| 굴절 지수 |
1.737 |
| 인화점 |
36.3°C |
| 위험성 표시 |
 C:Corrosive;
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
