ChemNet > CAS > 15219-34-8 Oxalyl bromide
15219-34-8 Oxalyl bromide
상품명칭 |
Oxalyl bromide |
별명 |
Ethanedioyl dibromide; Ethanedioyl bromide; NSC 96957; Oxalyl bromide |
분자식 |
C2Br2O2 |
분자량 |
215.8282 |
InChI |
InChI=1/C2Br2O2/c3-1(5)2(4)6 |
cas번호 |
15219-34-8 |
EC번호 |
239-271-7 |
분자 구조 |
|
밀도 |
2.627g/cm3 |
녹는 점 |
-19℃ |
비등점 |
118.3°C at 760 mmHg |
굴절 지수 |
1.567 |
인화점 |
109.8°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|