ChemNet > CAS > 154264-95-6 7-bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine
154264-95-6 7-bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine
상품명칭 |
7-bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine |
별명 |
7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine |
분자식 |
C9H10BrNO |
분자량 |
228.0858 |
InChI |
InChI=1/C9H10BrNO/c1-11-4-5-12-9-6-7(10)2-3-8(9)11/h2-3,6H,4-5H2,1H3 |
cas번호 |
154264-95-6 |
분자 구조 |
|
밀도 |
1.476g/cm3 |
비등점 |
309.187°C at 760 mmHg |
굴절 지수 |
1.579 |
인화점 |
140.792°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|