ChemNet > CAS > 1544-86-1 4-(difluoromethoxy)nitrobenzene
1544-86-1 4-(difluoromethoxy)nitrobenzene
| 상품명칭 |
4-(difluoromethoxy)nitrobenzene |
| 별명 |
1-(Difluoromethoxy)-4-nitrobenzene; 1-(difluoromethyl)-4-nitrobenzene |
| 분자식 |
C7H5F2NO2 |
| 분자량 |
173.1169 |
| InChI |
InChI=1/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
| cas번호 |
1544-86-1 |
| 분자 구조 |
|
| 밀도 |
1.339g/cm3 |
| 녹는 점 |
33-110℃ |
| 비등점 |
240.7°C at 760 mmHg |
| 굴절 지수 |
1.5 |
| 인화점 |
111.9°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
