ChemNet > CAS > 154607-01-9 4-Bromo-2-chlorobenzonitrile
154607-01-9 4-Bromo-2-chlorobenzonitrile
| 상품명칭 |
4-Bromo-2-chlorobenzonitrile |
| 별명 |
2-Chloro-4-Bromobenzonitrile |
| 분자식 |
C7H3BrClN |
| 분자량 |
216.4624 |
| InChI |
InChI=1/C7H3BrClN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| cas번호 |
154607-01-9 |
| 분자 구조 |
|
| 밀도 |
1.74g/cm3 |
| 비등점 |
279.8°C at 760 mmHg |
| 굴절 지수 |
1.623 |
| 인화점 |
123°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
