상품명칭 |
1,2,3,4-Tetraphenyl-1,3-cyclopentadiene |
별명 |
1,2,3,4-Tetraphenylcyclopenta-1,3-diene; 1,2,3,4-Tetraphenylcyclopentadiene; NSC 72113; 1,3-Cyclopentadiene, 1,2,3,4-tetraphenyl- (8CI); Benzene, 1,1',1'',1'''-(1,3-cyclopentadiene-1,2,3,4-tetrayl)tetrakis- (9CI); 1,1',1'',1'''-cyclopenta-1,3-diene-1,2,3,4-tetrayltetrabenzene |
분자식 |
C29H22 |
분자량 |
370.485 |
InChI |
InChI=1/C29H22/c1-5-13-22(14-6-1)26-21-27(23-15-7-2-8-16-23)29(25-19-11-4-12-20-25)28(26)24-17-9-3-10-18-24/h1-20H,21H2 |
cas번호 |
15570-45-3 |
EC번호 |
239-619-8 |
분자 구조 |
|
밀도 |
1.143g/cm3 |
녹는 점 |
179-182℃ |
비등점 |
542.3°C at 760 mmHg |
굴절 지수 |
1.662 |
인화점 |
280.9°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|