ChemNet > CAS > 1583-59-1 2,2-Difluoro-1,3-benzodioxole
1583-59-1 2,2-Difluoro-1,3-benzodioxole
상품명칭 |
2,2-Difluoro-1,3-benzodioxole |
별명 |
1,2-[(Difluoromethylene)dioxy]benzene; 2,2-difluorobenzo[d][1,3]dioxole; 2,2-Difluorobenzodioxole; 2,2-Difluoro-2H-1,3-benzodioxole |
분자식 |
C7H4F2O2 |
분자량 |
158.1023 |
InChI |
InChI=1/C7H4F2O2/c8-7(9)10-5-3-1-2-4-6(5)11-7/h1-4H |
cas번호 |
1583-59-1 |
EC번호 |
216-431-4 |
분자 구조 |
|
밀도 |
1.42g/cm3 |
비등점 |
125.1°C at 760 mmHg |
굴절 지수 |
1.509 |
인화점 |
35.1°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|