ChemNet > CAS > 15892-23-6 (+/-)-2-butanol
15892-23-6 (+/-)-2-butanol
| 상품명칭 |
(+/-)-2-butanol |
| 별명 |
(±)-2-Butanol; .+/-.-2-Butanol; 15892-23-6; DL-Butan-2-ol; DL-METHYLETHYLCARBINOL; dl-sec-Butanol; methyl-2-propanol; butan-2-ol |
| 분자식 |
C4H10O |
| 분자량 |
74.1216 |
| InChI |
InChI=1/C4H10O/c1-3-4(2)5/h4-5H,3H2,1-2H3 |
| cas번호 |
15892-23-6 |
| EC번호 |
240-029-8 |
| 분자 구조 |
|
| 밀도 |
0.801g/cm3 |
| 비등점 |
96.6°C at 760 mmHg |
| 굴절 지수 |
1.393 |
| 인화점 |
26.7°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R10:Flammable.;
R36/37:Irritating to eyes and respiratory system.;
|
| 보안 규칙 |
S13:Keep away from food, drink and animal feeding stuffs.;
S24/25:Avoid contact with skin and eyes.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S46:If swallowed, seek medical advice immediately and show this container or label.;
S7/9:Keep container tightly closed and in a well-ventilated place.;
|
|
