ChemNet > CAS > 16152-51-5 4-Isopropylbenzeneboronic acid
16152-51-5 4-Isopropylbenzeneboronic acid
| 상품명칭 |
4-Isopropylbenzeneboronic acid |
| 별명 |
4-Cumylboronic acid; [4-(1-methylethyl)phenyl]boronic acid; 4-Isopropylphenylboronic acid; 4-Isoprophenylboronic Acid |
| 분자식 |
C9H13BO2 |
| 분자량 |
164.0093 |
| InChI |
InChI=1/C9H13BO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7,11-12H,1-2H3 |
| cas번호 |
16152-51-5 |
| 분자 구조 |
|
| 밀도 |
1.04g/cm3 |
| 비등점 |
285.9°C at 760 mmHg |
| 굴절 지수 |
1.513 |
| 인화점 |
126.7°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
