ChemNet > CAS > 1620-76-4 2-Cyano-4-methylpyridine
1620-76-4 2-Cyano-4-methylpyridine
| 상품명칭 |
2-Cyano-4-methylpyridine |
| 별명 |
2-Cyano-4-picoline; 4-Methylpicolinonitrile; 4-Methyl-2-pyridinecarbonitrile; 4-methylpyridine-2-carbonitrile |
| 분자식 |
C7H6N2 |
| 분자량 |
118.1359 |
| InChI |
InChI=1/C7H6N2/c1-6-2-3-9-7(4-6)5-8/h2-4H,1H3 |
| cas번호 |
1620-76-4 |
| EC번호 |
244-131-3 |
| 분자 구조 |
|
| 밀도 |
1.08g/cm3 |
| 비등점 |
261.1°C at 760 mmHg |
| 굴절 지수 |
1.531 |
| 인화점 |
99.9°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
