ChemNet > CAS > 162101-31-7 2-Fluoro-4-methoxybenzeneboronic acid
162101-31-7 2-Fluoro-4-methoxybenzeneboronic acid
상품명칭 |
2-Fluoro-4-methoxybenzeneboronic acid |
별명 |
2-Fluoro-4-methoxyphenylboronic acid; Fluoro-4-methoxyphenylboronic acid |
분자식 |
C7H8BFO3 |
분자량 |
169.946 |
InChI |
InChI=1/C7H8BFO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,1H3 |
cas번호 |
162101-31-7 |
분자 구조 |
|
밀도 |
1.265g/cm3 |
비등점 |
291.169°C at 760 mmHg |
굴절 지수 |
1.504 |
인화점 |
129.895°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|