ChemNet > CAS > 1641-17-4 mexenone
1641-17-4 mexenone
상품명칭 |
mexenone |
별명 |
2-Hydroxy-4-methoxy-4-methylbenzophenone; 2-HYDROXY-4-METHOXY-4'-METHYLBENZOPHENONE; LABOTEST-BB LT00455260; ''MEXENONE''; BENZOPHENONE-10; benzophenone-10,2-hydroxy-4-methoxy-4’-methylbenzophenone; (2-Hydroxy-4-methoxyphenyl)(4-methylphenyl)methanone; HYDROXYMETHOXYMETHYLBENZOPHENONE |
분자식 |
C15H14O3 |
분자량 |
242.2699 |
InChI |
InChI=1/C15H14O3/c1-10-3-5-11(6-4-10)15(17)13-8-7-12(18-2)9-14(13)16/h3-9,16H,1-2H3 |
cas번호 |
1641-17-4 |
EC번호 |
216-688-2 |
분자 구조 |
|
밀도 |
1.174g/cm3 |
비등점 |
400.1°C at 760 mmHg |
굴절 지수 |
1.588 |
인화점 |
150.2°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|