ChemNet > CAS > 16713-66-9 3,3-Tetramethyleneglutaric acid
16713-66-9 3,3-Tetramethyleneglutaric acid
상품명칭 |
3,3-Tetramethyleneglutaric acid |
별명 |
Cyclopentane-1,1-diacetic acid; 1,1-cyclopentanediacetic acid; 2,2'-cyclopentane-1,1-diyldiacetic acid; 2,2'-cyclopentane-1,1-diyldiacetate |
분자식 |
C9H12O4 |
분자량 |
184.1903 |
InChI |
InChI=1/C9H14O4/c10-7(11)5-9(6-8(12)13)3-1-2-4-9/h1-6H2,(H,10,11)(H,12,13)/p-2 |
cas번호 |
16713-66-9 |
EC번호 |
240-761-8 |
분자 구조 |
|
녹는 점 |
180-181℃ |
비등점 |
396.2°C at 760 mmHg |
인화점 |
207.6°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|