ChemNet > CAS > 1674-30-2 2-chloro-1-phenylethanol
1674-30-2 2-chloro-1-phenylethanol
| 상품명칭 |
2-chloro-1-phenylethanol |
| 별명 |
styrene chlorohydrin; [2-(chloromethyl)phenyl]methanol |
| 분자식 |
C8H9ClO |
| 분자량 |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c9-5-7-3-1-2-4-8(7)6-10/h1-4,10H,5-6H2 |
| cas번호 |
1674-30-2 |
| EC번호 |
216-816-7 |
| 분자 구조 |
|
| 밀도 |
1.196g/cm3 |
| 비등점 |
267.289°C at 760 mmHg |
| 굴절 지수 |
1.562 |
| 인화점 |
119.526°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
