ChemNet > CAS > 1677-46-9 4-hydroxy-1-methyl-2(1H)quinolone
1677-46-9 4-hydroxy-1-methyl-2(1H)quinolone
상품명칭 |
4-hydroxy-1-methyl-2(1H)quinolone |
별명 |
4-Hydroxy-1-methyl-2(1H)-quinolone; 4-Hydroxy-1-methyl-2-quinolone; 4-Hydroxy-1-Metyl-2-(1H)Quinolone; 4-Hydroxy-1-methyl-1,2-dihydroquinolin-2-one; 2-hydroxy-1-methylquinolin-4(1H)-one; 4-hydroxy-1-methylquinolin-2(1H)-one |
분자식 |
C10H9NO2 |
분자량 |
175.184 |
InChI |
InChI=1/C10H9NO2/c1-11-8-5-3-2-4-7(8)9(12)6-10(11)13/h2-6,12H,1H3 |
cas번호 |
1677-46-9 |
EC번호 |
216-830-3 |
분자 구조 |
|
밀도 |
1.326g/cm3 |
녹는 점 |
269-271℃ |
비등점 |
297.555°C at 760 mmHg |
굴절 지수 |
1.647 |
인화점 |
133.756°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|