ChemNet > CAS > 16932-49-3 2,6-Dimethoxybenzonitrile
16932-49-3 2,6-Dimethoxybenzonitrile
상품명칭 |
2,6-Dimethoxybenzonitrile |
별명 |
Benzonitrile, 2,6-dimethoxy-; 2-10-00-00260 (Beilstein Handbook Reference); BRN 2720059 |
분자식 |
C9H9NO2 |
분자량 |
163.1733 |
InChI |
InChI=1/C9H9NO2/c1-11-8-4-3-5-9(12-2)7(8)6-10/h3-5H,1-2H3 |
cas번호 |
16932-49-3 |
EC번호 |
241-000-2 |
분자 구조 |
|
밀도 |
1.12g/cm3 |
녹는 점 |
119-123℃ |
비등점 |
306.7°C at 760 mmHg |
굴절 지수 |
1.519 |
인화점 |
128.8°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|