ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
상품명칭 |
3-Fluoro-4-methylbenzonitrile |
별명 |
4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
분자식 |
C8H6FN |
분자량 |
135.1383 |
InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
cas번호 |
170572-49-3 |
분자 구조 |
|
밀도 |
1.117g/cm3 |
녹는 점 |
48-50℃ |
비등점 |
215.069°C at 760 mmHg |
굴절 지수 |
1.508 |
인화점 |
90.3°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|