ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
| 상품명칭 |
3-Fluoro-4-methylbenzonitrile |
| 별명 |
4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
| 분자식 |
C8H6FN |
| 분자량 |
135.1383 |
| InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
| cas번호 |
170572-49-3 |
| 분자 구조 |
|
| 밀도 |
1.117g/cm3 |
| 녹는 점 |
48-50℃ |
| 비등점 |
215.069°C at 760 mmHg |
| 굴절 지수 |
1.508 |
| 인화점 |
90.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|
