ChemNet > CAS > 1706-11-2 2,5-Dimethylanisole
1706-11-2 2,5-Dimethylanisole
상품명칭 |
2,5-Dimethylanisole |
별명 |
1,4-Dimethyl-2-methoxybenzene; 2-Methoxy-p-xylene; 2,5-dimethylphenyl methyl ether |
분자식 |
C9H12O |
분자량 |
136.191 |
InChI |
InChI=1/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3 |
cas번호 |
1706-11-2 |
EC번호 |
216-943-8 |
분자 구조 |
|
밀도 |
0.932g/cm3 |
비등점 |
189.7°C at 760 mmHg |
굴절 지수 |
1.495 |
인화점 |
66.1°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|