ChemNet > CAS > 1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
상품명칭 |
1,6-Diphenyl-1,3,5-hexatriene |
별명 |
DPH; 1,1'-hexa-1,3,5-triene-1,6-diyldibenzene; 1,1'-(1E,3E,5E)-hexa-1,3,5-triene-1,6-diyldibenzene; 1-phenylhexa-1,3,5-trienylbenzene |
분자식 |
C18H16 |
분자량 |
232.3196 |
InChI |
InChI=1/C18H16/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h2-15H,1H2 |
cas번호 |
1720-32-7 |
EC번호 |
217-011-3 |
분자 구조 |
|
밀도 |
0.988g/cm3 |
녹는 점 |
199-203℃ |
비등점 |
361°C at 760 mmHg |
굴절 지수 |
1.585 |
인화점 |
185.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|