ChemNet > CAS > 17216-08-9 2-Acetyl-1-tetralone
17216-08-9 2-Acetyl-1-tetralone
상품명칭 |
2-Acetyl-1-tetralone |
별명 |
2-acetyl-1,2,3,4-tetrahydronaphthalen-1-one; 2-acetyl-3,4-dihydronaphthalen-1(2H)-one; 1-(1-hydroxy-3,4-dihydronaphthalen-2-yl)ethanone |
분자식 |
C12H12O2 |
분자량 |
188.2225 |
InChI |
InChI=1/C12H12O2/c1-8(13)10-7-6-9-4-2-3-5-11(9)12(10)14/h2-5,14H,6-7H2,1H3 |
cas번호 |
17216-08-9 |
EC번호 |
241-259-1 |
분자 구조 |
|
밀도 |
1.223g/cm3 |
녹는 점 |
55-57℃ |
비등점 |
359.4°C at 760 mmHg |
굴절 지수 |
1.611 |
인화점 |
153.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|