ChemNet > CAS > 1732-13-4 1,2,3,6,7,8-Hexahydropyrene
1732-13-4 1,2,3,6,7,8-Hexahydropyrene
상품명칭 |
1,2,3,6,7,8-Hexahydropyrene |
별명 |
NSC 60599; Pyrene, 1,2,3,6,7,8-hexahydro- (8CI)(9CI) |
분자식 |
C16H16 |
분자량 |
208.2982 |
InChI |
InChI=1/C16H16/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h7-10H,1-6H2 |
cas번호 |
1732-13-4 |
EC번호 |
217-061-6 |
분자 구조 |
|
밀도 |
1.146g/cm3 |
녹는 점 |
132-136℃ |
비등점 |
397.2°C at 760 mmHg |
굴절 지수 |
1.677 |
인화점 |
213.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|