ChemNet > CAS > 17356-19-3 1-Ethynylcyclopentanol
17356-19-3 1-Ethynylcyclopentanol
| 상품명칭 |
1-Ethynylcyclopentanol |
| 분자식 |
C7H10O |
| 분자량 |
110.1537 |
| InChI |
InChI=1/C7H10O/c1-2-7(8)5-3-4-6-7/h1,8H,3-6H2 |
| cas번호 |
17356-19-3 |
| EC번호 |
241-385-7 |
| 분자 구조 |
|
| 밀도 |
1.01g/cm3 |
| 녹는 점 |
27-159℃ |
| 비등점 |
155.4°C at 760 mmHg |
| 굴절 지수 |
1.497 |
| 인화점 |
48.9°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R10:Flammable.;
R22:Harmful if swallowed.;
R36/37:Irritating to eyes and respiratory system.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S39:Wear eye/face protection.;
|
|
