ChemNet > CAS > 175204-41-8 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile
175204-41-8 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile
상품명칭 |
3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile |
별명 |
3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbothioamide |
분자식 |
C11H8ClFN2OS |
분자량 |
270.7104 |
InChI |
InChI=1/C11H8ClFN2OS/c1-5-8(11(14)17)10(15-16-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H2,14,17) |
cas번호 |
175204-41-8 |
분자 구조 |
|
밀도 |
1.426g/cm3 |
녹는 점 |
85℃ |
비등점 |
408.4°C at 760 mmHg |
굴절 지수 |
1.625 |
인화점 |
200.8°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|