ChemNet > CAS > 175204-60-1 4-(ethylthio)-6-isopropyl-1,3,5-triazin-2-amine
175204-60-1 4-(ethylthio)-6-isopropyl-1,3,5-triazin-2-amine
상품명칭 |
4-(ethylthio)-6-isopropyl-1,3,5-triazin-2-amine |
별명 |
4-(ethylsulfanyl)-6-(1-methylethyl)-1,3,5-triazin-2-amine |
분자식 |
C8H14N4S |
분자량 |
198.2886 |
InChI |
InChI=1/C8H14N4S/c1-4-13-8-11-6(5(2)3)10-7(9)12-8/h5H,4H2,1-3H3,(H2,9,10,11,12) |
cas번호 |
175204-60-1 |
분자 구조 |
|
밀도 |
1.17g/cm3 |
녹는 점 |
114℃ |
비등점 |
404.7°C at 760 mmHg |
굴절 지수 |
1.565 |
인화점 |
198.6°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|