ChemNet > CAS > 175277-49-3 6-methoxypyridine-3-carbothioamide
175277-49-3 6-methoxypyridine-3-carbothioamide
상품명칭 |
6-methoxypyridine-3-carbothioamide |
별명 |
6-methoxy-3-Pyridinecarbothioamide |
분자식 |
C7H8N2OS |
분자량 |
168.2162 |
InChI |
InChI=1/C7H8N2OS/c1-10-6-3-2-5(4-9-6)7(8)11/h2-4H,1H3,(H2,8,11) |
cas번호 |
175277-49-3 |
분자 구조 |
|
밀도 |
1.262g/cm3 |
녹는 점 |
150℃ |
비등점 |
292.5°C at 760 mmHg |
굴절 지수 |
1.626 |
인화점 |
130.7°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|