ChemNet > CAS > 175278-28-1 5-Fluoro-2-methylbenzamide
175278-28-1 5-Fluoro-2-methylbenzamide
상품명칭 |
5-Fluoro-2-methylbenzamide |
분자식 |
C8H8FNO |
분자량 |
153.1536 |
InChI |
InChI=1/C8H8FNO/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H2,10,11) |
cas번호 |
175278-28-1 |
분자 구조 |
|
밀도 |
1.19g/cm3 |
녹는 점 |
120℃ |
비등점 |
214.6°C at 760 mmHg |
굴절 지수 |
1.534 |
인화점 |
83.6°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|