ChemNet > CAS > 177842-14-7 4-(difluoromethoxy)benzylamine
177842-14-7 4-(difluoromethoxy)benzylamine
| 상품명칭 |
4-(difluoromethoxy)benzylamine |
| 별명 |
1-[4-(difluoromethoxy)phenyl]methanamine |
| 분자식 |
C8H9F2NO |
| 분자량 |
173.16 |
| InChI |
InChI=1/C8H9F2NO/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-4,8H,5,11H2 |
| cas번호 |
177842-14-7 |
| 분자 구조 |
|
| 밀도 |
1.196g/cm3 |
| 비등점 |
227.3°C at 760 mmHg |
| 굴절 지수 |
1.487 |
| 인화점 |
91.3°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R34:Causes burns.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
