ChemNet > CAS > 1780-17-2 2-quinolylmethanol
1780-17-2 2-quinolylmethanol
| 상품명칭 |
2-quinolylmethanol |
| 별명 |
2-Hydroxymethylquinoline; 2-Quinolinylmethanol; 2-Quinolinemethanol; quinolin-2-ylmethanol |
| 분자식 |
C10H9NO |
| 분자량 |
159.1846 |
| InChI |
InChI=1/C10H9NO/c12-7-9-6-5-8-3-1-2-4-10(8)11-9/h1-6,12H,7H2 |
| cas번호 |
1780-17-2 |
| EC번호 |
217-225-7 |
| 분자 구조 |
|
| 밀도 |
1.218g/cm3 |
| 비등점 |
310.6°C at 760 mmHg |
| 굴절 지수 |
1.667 |
| 인화점 |
141.6°C |
| 위험성 표시 |
 Xi:Irritant;
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
