ChemNet > CAS > 1838-94-4 2-methyl-2-vinyloxirane
1838-94-4 2-methyl-2-vinyloxirane
| 상품명칭 |
2-methyl-2-vinyloxirane |
| 분자식 |
C5H8O |
| 분자량 |
84.1164 |
| InChI |
InChI=1/C5H8O/c1-3-5(2)4-6-5/h3H,1,4H2,2H3 |
| cas번호 |
1838-94-4 |
| 분자 구조 |
|
| 밀도 |
1.006g/cm3 |
| 비등점 |
78.7°C at 760 mmHg |
| 굴절 지수 |
1.54 |
| 위험성 표시 |
|
| 리스크 규칙 |
R11:Highly flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S33:Take precautionary measures against static discharges.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
