ChemNet > CAS > 1884-68-0 2,3,4,5-Tetraphenylthiophene
1884-68-0 2,3,4,5-Tetraphenylthiophene
상품명칭 |
2,3,4,5-Tetraphenylthiophene |
별명 |
Tetraphenylthiophene |
분자식 |
C28H20S |
분자량 |
388.5234 |
InChI |
InChI=1/C28H20S/c1-5-13-21(14-6-1)25-26(22-15-7-2-8-16-22)28(24-19-11-4-12-20-24)29-27(25)23-17-9-3-10-18-23/h1-20H |
cas번호 |
1884-68-0 |
EC번호 |
217-545-7 |
분자 구조 |
|
밀도 |
1.142g/cm3 |
비등점 |
402.2°C at 760 mmHg |
굴절 지수 |
1.643 |
인화점 |
147.8°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|