ChemNet > CAS > 18984-21-9 2,4-Dichloro-beta-nitrostyrene
18984-21-9 2,4-Dichloro-beta-nitrostyrene
| 상품명칭 |
2,4-Dichloro-beta-nitrostyrene |
| 별명 |
1-(2,4-Dichlorophenyl)-2-nitroethene; 2,4-dichloro-1-(2-nitroethenyl)benzene; 2,4-dichloro-1-[(E)-2-nitroethenyl]benzene |
| 분자식 |
C8H5Cl2NO2 |
| 분자량 |
218.0368 |
| InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-6(8(10)5-7)3-4-11(12)13/h1-5H/b4-3+ |
| cas번호 |
18984-21-9 |
| 분자 구조 |
|
| 밀도 |
1.447g/cm3 |
| 비등점 |
334.1°C at 760 mmHg |
| 굴절 지수 |
1.626 |
| 인화점 |
155.9°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
