ChemNet > CAS > 18984-21-9 2,4-Dichloro-beta-nitrostyrene
18984-21-9 2,4-Dichloro-beta-nitrostyrene
상품명칭 |
2,4-Dichloro-beta-nitrostyrene |
별명 |
1-(2,4-Dichlorophenyl)-2-nitroethene; 2,4-dichloro-1-(2-nitroethenyl)benzene; 2,4-dichloro-1-[(E)-2-nitroethenyl]benzene |
분자식 |
C8H5Cl2NO2 |
분자량 |
218.0368 |
InChI |
InChI=1/C8H5Cl2NO2/c9-7-2-1-6(8(10)5-7)3-4-11(12)13/h1-5H/b4-3+ |
cas번호 |
18984-21-9 |
분자 구조 |
|
밀도 |
1.447g/cm3 |
비등점 |
334.1°C at 760 mmHg |
굴절 지수 |
1.626 |
인화점 |
155.9°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|