ChemNet > CAS > 19056-40-7 4-Bromo-3-methoxyaniline
19056-40-7 4-Bromo-3-methoxyaniline
| 상품명칭 |
4-Bromo-3-methoxyaniline |
| 별명 |
4-Bromo-m-anisidine; 4-nitrophenyl 2-aminobenzoate; 4-Bromo-3-Methoxy-Phenylamine |
| 분자식 |
C13H10N2O4 |
| 분자량 |
258.2295 |
| InChI |
InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
| cas번호 |
19056-40-7 |
| 분자 구조 |
|
| 밀도 |
1.381g/cm3 |
| 비등점 |
467°C at 760 mmHg |
| 굴절 지수 |
1.655 |
| 인화점 |
236.2°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
