ChemNet > CAS > 191-07-1 Coronene
191-07-1 Coronene
상품명칭 |
Coronene |
별명 |
Hexabenzobenzene; Coronene (purity) |
분자식 |
C24H12 |
분자량 |
300.3521 |
InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
cas번호 |
191-07-1 |
EC번호 |
205-881-7 |
분자 구조 |
|
밀도 |
1.467g/cm3 |
녹는 점 |
438-440℃ |
비등점 |
525.6°C at 760 mmHg |
굴절 지수 |
2.139 |
인화점 |
265.2°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|