ChemNet > CAS > 19144-86-6 (S)-(-)-N-Acetyl-1-methylbenzylamine
19144-86-6 (S)-(-)-N-Acetyl-1-methylbenzylamine
상품명칭 |
(S)-(-)-N-Acetyl-1-methylbenzylamine |
별명 |
(3beta)-3-hydroxycholest-5-en-22-one; N-[(1S)-1-phenylethyl]acetamide |
분자식 |
C10H13NO |
분자량 |
163.2163 |
InChI |
InChI=1/C10H13NO/c1-8(11-9(2)12)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,11,12)/t8-/m0/s1 |
cas번호 |
19144-86-6 |
분자 구조 |
|
밀도 |
1.007g/cm3 |
녹는 점 |
102℃ |
비등점 |
327.9°C at 760 mmHg |
굴절 지수 |
1.513 |
인화점 |
192.2°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|