ChemNet > CAS > 19398-61-9 2,5-Dichlorotoluene
19398-61-9 2,5-Dichlorotoluene
상품명칭 |
2,5-Dichlorotoluene |
별명 |
Benzene, 1,4-dichloro-2-methyl-; NSC 86117; Toluene, 2,5-dichloro- (8CI); 1,4-dichloro-2-methylbenzene |
분자식 |
C7H6Cl2 |
분자량 |
161.0285 |
InChI |
InChI=1/C7H6Cl2/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
cas번호 |
19398-61-9 |
EC번호 |
243-032-2 |
분자 구조 |
|
밀도 |
1.242g/cm3 |
녹는 점 |
4-5℃ |
비등점 |
197.4°C at 760 mmHg |
굴절 지수 |
1.543 |
인화점 |
79.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|