ChemNet > CAS > 19462-98-7 5,6-Dichlorobenzimidazole-2-thiol
19462-98-7 5,6-Dichlorobenzimidazole-2-thiol
| 상품명칭 |
5,6-Dichlorobenzimidazole-2-thiol |
| 별명 |
5,6-Dichloro-1H-benzo[d]imidazole-2-thiol; 5,6-dichloro-1,3-dihydro-2H-benzimidazole-2-thione |
| 분자식 |
C7H4Cl2N2S |
| 분자량 |
219.0911 |
| InChI |
InChI=1/C7H4Cl2N2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
| cas번호 |
19462-98-7 |
| 분자 구조 |
|
| 밀도 |
1.68g/cm3 |
| 녹는 점 |
300℃ |
| 비등점 |
329.8°C at 760 mmHg |
| 굴절 지수 |
1.755 |
| 인화점 |
153.3°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
