ChemNet > CAS > 195209-93-9 Diisopropyl chloromalonate
195209-93-9 Diisopropyl chloromalonate
상품명칭 |
Diisopropyl chloromalonate |
별명 |
Chloromalonic acid diisopropyl ester; bis(1-methylethyl) chloropropanedioate |
분자식 |
C9H15ClO4 |
분자량 |
222.666 |
InChI |
InChI=1/C9H15ClO4/c1-5(2)13-8(11)7(10)9(12)14-6(3)4/h5-7H,1-4H3 |
cas번호 |
195209-93-9 |
분자 구조 |
|
밀도 |
1.132g/cm3 |
비등점 |
238.1°C at 760 mmHg |
굴절 지수 |
1.442 |
인화점 |
83.3°C |
위험성 표시 |
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|