ChemNet > CAS > 19788-49-9 Mercaptopropionicacidethylester
19788-49-9 Mercaptopropionicacidethylester
상품명칭 |
Mercaptopropionicacidethylester |
별명 |
2-Mercaptopropionic acid ethyl ester; Ethyl thiolactate~2-Mercaptopropionic acid ethyl ester; ethyl 2-sulfanylpropanoate; Ethyl 2-mercaptopropionate |
분자식 |
C5H10O2S |
분자량 |
134.1967 |
InChI |
InChI=1/C5H10O2S/c1-3-7-5(6)4(2)8/h4,8H,3H2,1-2H3 |
cas번호 |
19788-49-9 |
EC번호 |
243-314-5 |
분자 구조 |
|
밀도 |
1.04g/cm3 |
비등점 |
171.7°C at 760 mmHg |
굴절 지수 |
1.452 |
인화점 |
57.4°C |
위험성 표시 |
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|