ChemNet > CAS > 1984-59-4 2,3-Dichloroanisole
1984-59-4 2,3-Dichloroanisole
상품명칭 |
2,3-Dichloroanisole |
별명 |
1,2-Dichloro-3-methoxybenzene; ; 1,2-dichloro-3-methoxybenzene |
분자식 |
C7H6Cl2O |
분자량 |
177.0279 |
InChI |
InChI=1/C7H6Cl2O/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,1H3 |
cas번호 |
1984-59-4 |
EC번호 |
217-853-1 |
분자 구조 |
|
밀도 |
1.289g/cm3 |
녹는 점 |
30-35℃ |
비등점 |
223.4°C at 760 mmHg |
굴절 지수 |
1.534 |
인화점 |
94.7°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|