ChemNet > CAS > 2001-29-8 benzyl 4-brornophenyl ketone
2001-29-8 benzyl 4-brornophenyl ketone
| 상품명칭 |
benzyl 4-brornophenyl ketone |
| 별명 |
4-Bromodeoxybenzoin~4-Bromo-alpha-phenylacetophenone; Benzyl 4-bromophenyl ketone; 1-(4-bromophenyl)-2-phenylethanone; 4'-Bromo-2-Phenylacetophenone |
| 분자식 |
C14H11BrO |
| 분자량 |
275.1405 |
| InChI |
InChI=1/C14H11BrO/c15-13-8-6-12(7-9-13)14(16)10-11-4-2-1-3-5-11/h1-9H,10H2 |
| cas번호 |
2001-29-8 |
| 분자 구조 |
|
| 밀도 |
1.39g/cm3 |
| 녹는 점 |
112-116℃ |
| 비등점 |
383.2°C at 760 mmHg |
| 굴절 지수 |
1.608 |
| 인화점 |
84.6°C |
| 위험성 표시 |
|
| 리스크 규칙 |
|
| 보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
