ChemNet > CAS > 2001-93-6 Dithiouracil
2001-93-6 Dithiouracil
상품명칭 |
Dithiouracil |
별명 |
2,4(1H,3H)-Pyrimidinedithione; 2,4-Dithiopyrimidine; pyrimidine-2,4-dithiol; pyrimidine-2,4(1H,3H)-dithione; 2,4-dimercaptopyrimidine |
분자식 |
C4H4N2S2 |
분자량 |
144.218 |
InChI |
InChI=1/C4H4N2S2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
cas번호 |
2001-93-6 |
EC번호 |
217-894-5 |
분자 구조 |
|
밀도 |
1.5g/cm3 |
녹는 점 |
279-281℃ |
비등점 |
225.6°C at 760 mmHg |
굴절 지수 |
1.776 |
인화점 |
90.3°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|