ChemNet > CAS > 20017-68-9 1-Bromo-3,3-diphenylpropane
20017-68-9 1-Bromo-3,3-diphenylpropane
상품명칭 |
1-Bromo-3,3-diphenylpropane |
별명 |
3,3-Diphenylpropyl bromide; 1,1'-(3-bromopropane-1,1-diyl)dibenzene |
분자식 |
C15H15Br |
분자량 |
275.1836 |
InChI |
InChI=1/C15H15Br/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
cas번호 |
20017-68-9 |
EC번호 |
243-467-8 |
분자 구조 |
|
밀도 |
1.275g/cm3 |
녹는 점 |
39-42℃ |
비등점 |
317.4°C at 760 mmHg |
굴절 지수 |
1.587 |
인화점 |
143.2°C |
위험성 표시 |
C:Corrosive;
|
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
|
|