ChemNet > CAS > 2005-08-5 4-chlorophenyl benzoate
2005-08-5 4-chlorophenyl benzoate
상품명칭 |
4-chlorophenyl benzoate |
별명 |
4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
분자식 |
C13H9ClO2 |
분자량 |
232.6624 |
InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
cas번호 |
2005-08-5 |
EC번호 |
217-910-0 |
분자 구조 |
|
밀도 |
1.258g/cm3 |
녹는 점 |
87-89℃ |
비등점 |
343.1°C at 760 mmHg |
굴절 지수 |
1.594 |
인화점 |
175.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|