ChemNet > CAS > 20280-81-3 4-Methoxycoumarin
20280-81-3 4-Methoxycoumarin
상품명칭 |
4-Methoxycoumarin |
별명 |
4-Methoxycourmarin; 2H-1-Benzopyran-2-one, 4-methoxy-; 4-methoxy-2H-chromen-2-one |
분자식 |
C10H8O3 |
분자량 |
176.1687 |
InChI |
InChI=1/C10H8O3/c1-12-9-6-10(11)13-8-5-3-2-4-7(8)9/h2-6H,1H3 |
cas번호 |
20280-81-3 |
분자 구조 |
|
밀도 |
1.26g/cm3 |
비등점 |
347.8°C at 760 mmHg |
굴절 지수 |
1.581 |
인화점 |
144.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|