ChemNet > CAS > 202865-85-8 2-Bromo-5-iodotoluene
202865-85-8 2-Bromo-5-iodotoluene
상품명칭 |
2-Bromo-5-iodotoluene |
별명 |
1-bromo-4-iodo-2-methylbenzene |
분자식 |
C7H6BrI |
분자량 |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
cas번호 |
202865-85-8 |
분자 구조 |
|
밀도 |
2.062g/cm3 |
비등점 |
264.2°C at 760 mmHg |
굴절 지수 |
1.636 |
인화점 |
113.6°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|