ChemNet > CAS > 202925-07-3 3-Chloro-4-fluoroanisole
202925-07-3 3-Chloro-4-fluoroanisole
| 상품명칭 |
3-Chloro-4-fluoroanisole |
| 별명 |
2-chloro-1-fluoro-4-methoxybenzene |
| 분자식 |
C7H6ClFO |
| 분자량 |
160.5733 |
| InChI |
InChI=1/C7H6ClFO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3 |
| cas번호 |
202925-07-3 |
| 분자 구조 |
|
| 밀도 |
1.239g/cm3 |
| 비등점 |
202.8°C at 760 mmHg |
| 굴절 지수 |
1.495 |
| 인화점 |
76.4°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
