CAS No: 207738-08-7, Chemical Name: 3,3',5,5'-tetramethylbiphenyl-4,4'-diamine hydrochloride hydrate
the physical and chemical property of 207738-08-7, 3,3',5,5'-tetramethylbiphenyl-4,4'-diamine hydrochloride hydrate is provided by ChemNet.com
ChemNet > CAS > 207738-08-7 3,3',5,5'-tetramethylbiphenyl-4,4'-diamine hydrochloride hydrate
207738-08-7 3,3',5,5'-tetramethylbiphenyl-4,4'-diamine hydrochloride hydrate
상품명칭 |
3,3',5,5'-tetramethylbiphenyl-4,4'-diamine hydrochloride hydrate |
별명 |
TMB dihydrochloride; TMB-2HCL-2H₂ O |
분자식 |
C16H23ClN2O |
분자량 |
294.8196 |
InChI |
InChI=1/C16H20N2.ClH.H2O/c1-9-5-13(6-10(2)15(9)17)14-7-11(3)16(18)12(4)8-14;;/h5-8H,17-18H2,1-4H3;1H;1H2 |
cas번호 |
207738-08-7 |
분자 구조 |
|
비등점 |
459.8°C at 760 mmHg |
인화점 |
231.9°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
|
|